C19H19N3O — CID 26365907
(3R)-4-phenyl-3-pyrrolidin-1-yl-1,3-dihydro-1,5-benzodiazepin-2-one (PubChem CID 26365907) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is (3R)-4-phenyl-3-pyrrolidin-1-yl-1,3-dihydro-1,5-benzodiazepin-2-one.
| Compound Name | (3R)-4-phenyl-3-pyrrolidin-1-yl-1,3-dihydro-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 26365907 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | (3R)-4-phenyl-3-pyrrolidin-1-yl-1,3-dihydro-1,5-benzodiazepin-2-one |
| SMILES | O=C1Nc2ccccc2N=C(c2ccccc2)[C@H]1N1CCCC1 |
| InChI | InChI=1S/C19H19N3O/c23-19-18(22-12-6-7-13-22)17(14-8-2-1-3-9-14)20-15-10-4-5-11-16(15)21-19/h1-5,8-11,18H,6-7,12-13H2,(H,21,23)/t18-/m1/s1 |
| InChIKey | IIJMEQVIGHCPQO-GOSISDBHSA-N |
| XLogP | 3.22 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |