C19H16BrN5O5S — CID 26366186
4-[(6R)-10-bromo-3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-2-ethoxy-3-nitrophenol (PubChem CID 26366186) has the molecular formula C19H16BrN5O5S and a molecular weight of 506.34 g/mol. Its IUPAC name is 4-[(6R)-10-bromo-3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-2-ethoxy-3-nitrophenol.
| Compound Name | 4-[(6R)-10-bromo-3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-2-ethoxy-3-nitrophenol |
|---|---|
| PubChem CID | 26366186 |
| Molecular Formula | C19H16BrN5O5S |
| Molecular Weight | 506.34 g/mol |
| Exact Mass | 505.01 |
| IUPAC Name | 4-[(6R)-10-bromo-3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-2-ethoxy-3-nitrophenol |
| SMILES | CCOc1c(O)ccc([C@@H]2Nc3ccc(Br)cc3-c3nnc(SC)nc3O2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16BrN5O5S/c1-3-29-16-13(26)7-5-10(15(16)25(27)28)17-21-12-6-4-9(20)8-11(12)14-18(30-17)22-19(31-2)24-23-14/h4-8,17,21,26H,3H2,1-2H3/t17-/m1/s1 |
| InChIKey | KNIMJNPQDOQJIV-QGZVFWFLSA-N |
| XLogP | 4.54 |
| TPSA | 132.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.34 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|