C31H34N4O2S — CID 26366199
4-[(6R)-3-benzylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-2,6-ditert-butylphenol (PubChem CID 26366199) has the molecular formula C31H34N4O2S and a molecular weight of 526.71 g/mol. Its IUPAC name is 4-[(6R)-3-benzylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-2,6-ditert-butylphenol.
| Compound Name | 4-[(6R)-3-benzylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 26366199 |
| Molecular Formula | C31H34N4O2S |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | 4-[(6R)-3-benzylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc([C@@H]2Nc3ccccc3-c3nnc(SCc4ccccc4)nc3O2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C31H34N4O2S/c1-30(2,3)22-16-20(17-23(26(22)36)31(4,5)6)27-32-24-15-11-10-14-21(24)25-28(37-27)33-29(35-34-25)38-18-19-12-8-7-9-13-19/h7-17,27,32,36H,18H2,1-6H3/t27-/m1/s1 |
| InChIKey | GNDONCZSFOCPSL-HHHXNRCGSA-N |
| XLogP | 7.63 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |