C22H20ClN5O4S — CID 26366230
1-[(6S)-3-butylsulfanyl-6-(4-chloro-3-nitrophenyl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone (PubChem CID 26366230) has the molecular formula C22H20ClN5O4S and a molecular weight of 485.95 g/mol. Its IUPAC name is 1-[(6S)-3-butylsulfanyl-6-(4-chloro-3-nitrophenyl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone.
| Compound Name | 1-[(6S)-3-butylsulfanyl-6-(4-chloro-3-nitrophenyl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
|---|---|
| PubChem CID | 26366230 |
| Molecular Formula | C22H20ClN5O4S |
| Molecular Weight | 485.95 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | 1-[(6S)-3-butylsulfanyl-6-(4-chloro-3-nitrophenyl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
| SMILES | CCCCSc1nnc2c(n1)O[C@@H](c1ccc(Cl)c([N+](=O)[O-])c1)N(C(C)=O)c1ccccc1-2 |
| InChI | InChI=1S/C22H20ClN5O4S/c1-3-4-11-33-22-24-20-19(25-26-22)15-7-5-6-8-17(15)27(13(2)29)21(32-20)14-9-10-16(23)18(12-14)28(30)31/h5-10,12,21H,3-4,11H2,1-2H3/t21-/m0/s1 |
| InChIKey | WOWIMBVCLQTKSQ-NRFANRHFSA-N |
| XLogP | 5.44 |
| TPSA | 111.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.95 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|