C7H8Br2N2O — CID 26369890
2,6-dibromo-5-ethoxypyridin-3-amine (PubChem CID 26369890) has the molecular formula C7H8Br2N2O and a molecular weight of 295.96 g/mol. Its IUPAC name is 2,6-dibromo-5-ethoxypyridin-3-amine.
| Compound Name | 2,6-dibromo-5-ethoxypyridin-3-amine |
|---|---|
| PubChem CID | 26369890 |
| Molecular Formula | C7H8Br2N2O |
| Molecular Weight | 295.96 g/mol |
| Exact Mass | 293.90 |
| IUPAC Name | 2,6-dibromo-5-ethoxypyridin-3-amine |
| SMILES | CCOc1cc(N)c(Br)nc1Br |
| InChI | InChI=1S/C7H8Br2N2O/c1-2-12-5-3-4(10)6(8)11-7(5)9/h3H,2,10H2,1H3 |
| InChIKey | JBYDYHKAHAUMOL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.96 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|