C19H29NO5 — CID 26385033
benzyl (3S)-3-(2,2-diethoxyethoxy)piperidine-1-carboxylate (PubChem CID 26385033) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is benzyl (3S)-3-(2,2-diethoxyethoxy)piperidine-1-carboxylate.
| Compound Name | benzyl (3S)-3-(2,2-diethoxyethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 26385033 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | benzyl (3S)-3-(2,2-diethoxyethoxy)piperidine-1-carboxylate |
| SMILES | CCOC(CO[C@H]1CCCN(C(=O)OCc2ccccc2)C1)OCC |
| InChI | InChI=1S/C19H29NO5/c1-3-22-18(23-4-2)15-24-17-11-8-12-20(13-17)19(21)25-14-16-9-6-5-7-10-16/h5-7,9-10,17-18H,3-4,8,11-15H2,1-2H3/t17-/m0/s1 |
| InChIKey | MXEYBNMIUNYEPC-KRWDZBQOSA-N |
| XLogP | 3.20 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|