C19H24N2OS — CID 26392166
[(3S)-3-(4-propan-2-ylanilino)piperidin-1-yl]-thiophen-3-ylmethanone (PubChem CID 26392166) has the molecular formula C19H24N2OS and a molecular weight of 328.48 g/mol. Its IUPAC name is [(3S)-3-(4-propan-2-ylanilino)piperidin-1-yl]-thiophen-3-ylmethanone.
| Compound Name | [(3S)-3-(4-propan-2-ylanilino)piperidin-1-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 26392166 |
| Molecular Formula | C19H24N2OS |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | [(3S)-3-(4-propan-2-ylanilino)piperidin-1-yl]-thiophen-3-ylmethanone |
| SMILES | CC(C)c1ccc(N[C@H]2CCCN(C(=O)c3ccsc3)C2)cc1 |
| InChI | InChI=1S/C19H24N2OS/c1-14(2)15-5-7-17(8-6-15)20-18-4-3-10-21(12-18)19(22)16-9-11-23-13-16/h5-9,11,13-14,18,20H,3-4,10,12H2,1-2H3/t18-/m0/s1 |
| InChIKey | PPVHJHDKNGAAMB-SFHVURJKSA-N |
| XLogP | 4.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |