C16H24N2OS — CID 146483126
1-[3-(4-propan-2-ylanilino)piperidin-1-yl]-2-sulfanylethanone (PubChem CID 146483126) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is 1-[3-(4-propan-2-ylanilino)piperidin-1-yl]-2-sulfanylethanone.
| Compound Name | 1-[3-(4-propan-2-ylanilino)piperidin-1-yl]-2-sulfanylethanone |
|---|---|
| PubChem CID | 146483126 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 1-[3-(4-propan-2-ylanilino)piperidin-1-yl]-2-sulfanylethanone |
| SMILES | CC(C)c1ccc(NC2CCCN(C(=O)CS)C2)cc1 |
| InChI | InChI=1S/C16H24N2OS/c1-12(2)13-5-7-14(8-6-13)17-15-4-3-9-18(10-15)16(19)11-20/h5-8,12,15,17,20H,3-4,9-11H2,1-2H3 |
| InChIKey | KPUBGCIPABTONO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|