C14H22ClN3O — CID 120705047
1-(3-anilinopiperidin-1-yl)-2-(methylamino)ethanone;hydrochloride (PubChem CID 120705047) has the molecular formula C14H22ClN3O and a molecular weight of 283.80 g/mol. Its IUPAC name is 1-(3-anilinopiperidin-1-yl)-2-(methylamino)ethanone;hydrochloride.
| Compound Name | 1-(3-anilinopiperidin-1-yl)-2-(methylamino)ethanone;hydrochloride |
|---|---|
| PubChem CID | 120705047 |
| Molecular Formula | C14H22ClN3O |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 1-(3-anilinopiperidin-1-yl)-2-(methylamino)ethanone;hydrochloride |
| SMILES | CNCC(=O)N1CCCC(Nc2ccccc2)C1.Cl |
| InChI | InChI=1S/C14H21N3O.ClH/c1-15-10-14(18)17-9-5-8-13(11-17)16-12-6-3-2-4-7-12;/h2-4,6-7,13,15-16H,5,8-11H2,1H3;1H |
| InChIKey | KZGHCTZQMQFYBP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |