C23H35N3O3 — CID 26395156
[3-(1-cyclopentylpiperidin-4-yl)oxyphenyl]-[4-(2-hydroxyethyl)piperazin-1-yl]methanone (PubChem CID 26395156) has the molecular formula C23H35N3O3 and a molecular weight of 401.55 g/mol. Its IUPAC name is [3-(1-cyclopentylpiperidin-4-yl)oxyphenyl]-[4-(2-hydroxyethyl)piperazin-1-yl]methanone.
| Compound Name | [3-(1-cyclopentylpiperidin-4-yl)oxyphenyl]-[4-(2-hydroxyethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 26395156 |
| Molecular Formula | C23H35N3O3 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | [3-(1-cyclopentylpiperidin-4-yl)oxyphenyl]-[4-(2-hydroxyethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cccc(OC2CCN(C3CCCC3)CC2)c1)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C23H35N3O3/c27-17-16-24-12-14-26(15-13-24)23(28)19-4-3-7-22(18-19)29-21-8-10-25(11-9-21)20-5-1-2-6-20/h3-4,7,18,20-21,27H,1-2,5-6,8-17H2 |
| InChIKey | YWOIOPADMVAYRZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |