C19H27N3O — CID 26396599
(5R)-2-[(E)-2-methylbut-2-enyl]-7-(pyridin-3-ylmethyl)-2,7-diazaspiro[4.5]decan-6-one (PubChem CID 26396599) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is (5R)-2-[(E)-2-methylbut-2-enyl]-7-(pyridin-3-ylmethyl)-2,7-diazaspiro[4.5]decan-6-one.
| Compound Name | (5R)-2-[(E)-2-methylbut-2-enyl]-7-(pyridin-3-ylmethyl)-2,7-diazaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 26396599 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | (5R)-2-[(E)-2-methylbut-2-enyl]-7-(pyridin-3-ylmethyl)-2,7-diazaspiro[4.5]decan-6-one |
| SMILES | C/C=C(\C)CN1CC[C@]2(CCCN(Cc3cccnc3)C2=O)C1 |
| InChI | InChI=1S/C19H27N3O/c1-3-16(2)13-21-11-8-19(15-21)7-5-10-22(18(19)23)14-17-6-4-9-20-12-17/h3-4,6,9,12H,5,7-8,10-11,13-15H2,1-2H3/b16-3+/t19-/m1/s1 |
| InChIKey | RDXKUYXAIYNDHN-KVMOOHLOSA-N |
| XLogP | 2.86 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|