C20H26F2N2O — CID 45200848
7-[(3,4-difluorophenyl)methyl]-2-[(E)-2-methylbut-2-enyl]-2,7-diazaspiro[4.5]decan-6-one (PubChem CID 45200848) has the molecular formula C20H26F2N2O and a molecular weight of 348.44 g/mol. Its IUPAC name is 7-[(3,4-difluorophenyl)methyl]-2-[(E)-2-methylbut-2-enyl]-2,7-diazaspiro[4.5]decan-6-one.
| Compound Name | 7-[(3,4-difluorophenyl)methyl]-2-[(E)-2-methylbut-2-enyl]-2,7-diazaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 45200848 |
| Molecular Formula | C20H26F2N2O |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 7-[(3,4-difluorophenyl)methyl]-2-[(E)-2-methylbut-2-enyl]-2,7-diazaspiro[4.5]decan-6-one |
| SMILES | C/C=C(\C)CN1CCC2(CCCN(Cc3ccc(F)c(F)c3)C2=O)C1 |
| InChI | InChI=1S/C20H26F2N2O/c1-3-15(2)12-23-10-8-20(14-23)7-4-9-24(19(20)25)13-16-5-6-17(21)18(22)11-16/h3,5-6,11H,4,7-10,12-14H2,1-2H3/b15-3+ |
| InChIKey | MLXSETSLNLJVDP-CRKCGEKBSA-N |
| XLogP | 3.75 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|