C20H27F2N3O2 — CID 26315460
(5S)-N-butyl-7-[(3,4-difluorophenyl)methyl]-6-oxo-2,7-diazaspiro[4.5]decane-2-carboxamide (PubChem CID 26315460) has the molecular formula C20H27F2N3O2 and a molecular weight of 379.45 g/mol. Its IUPAC name is (5S)-N-butyl-7-[(3,4-difluorophenyl)methyl]-6-oxo-2,7-diazaspiro[4.5]decane-2-carboxamide.
| Compound Name | (5S)-N-butyl-7-[(3,4-difluorophenyl)methyl]-6-oxo-2,7-diazaspiro[4.5]decane-2-carboxamide |
|---|---|
| PubChem CID | 26315460 |
| Molecular Formula | C20H27F2N3O2 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | (5S)-N-butyl-7-[(3,4-difluorophenyl)methyl]-6-oxo-2,7-diazaspiro[4.5]decane-2-carboxamide |
| SMILES | CCCCNC(=O)N1CC[C@@]2(CCCN(Cc3ccc(F)c(F)c3)C2=O)C1 |
| InChI | InChI=1S/C20H27F2N3O2/c1-2-3-9-23-19(27)25-11-8-20(14-25)7-4-10-24(18(20)26)13-15-5-6-16(21)17(22)12-15/h5-6,12H,2-4,7-11,13-14H2,1H3,(H,23,27)/t20-/m0/s1 |
| InChIKey | UFZHOJFSZYIUHB-FQEVSTJZSA-N |
| XLogP | 3.29 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|