C17H23F2N3O3 — CID 95190755
N-[2-[[(3S)-1-[(3,4-difluorophenyl)methyl]-3-hydroxy-2-oxopiperidin-3-yl]methylamino]ethyl]acetamide (PubChem CID 95190755) has the molecular formula C17H23F2N3O3 and a molecular weight of 355.39 g/mol. Its IUPAC name is N-[2-[[(3S)-1-[(3,4-difluorophenyl)methyl]-3-hydroxy-2-oxopiperidin-3-yl]methylamino]ethyl]acetamide.
| Compound Name | N-[2-[[(3S)-1-[(3,4-difluorophenyl)methyl]-3-hydroxy-2-oxopiperidin-3-yl]methylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 95190755 |
| Molecular Formula | C17H23F2N3O3 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | N-[2-[[(3S)-1-[(3,4-difluorophenyl)methyl]-3-hydroxy-2-oxopiperidin-3-yl]methylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNC[C@@]1(O)CCCN(Cc2ccc(F)c(F)c2)C1=O |
| InChI | InChI=1S/C17H23F2N3O3/c1-12(23)21-7-6-20-11-17(25)5-2-8-22(16(17)24)10-13-3-4-14(18)15(19)9-13/h3-4,9,20,25H,2,5-8,10-11H2,1H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | BBCOLEKCOPCFKM-KRWDZBQOSA-N |
| XLogP | 0.54 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|