C16H22F2N2O4S — CID 95216266
(3R)-1-[(3,4-difluorophenyl)methyl]-3-hydroxy-3-[(2-methylsulfonylethylamino)methyl]piperidin-2-one (PubChem CID 95216266) has the molecular formula C16H22F2N2O4S and a molecular weight of 376.43 g/mol. Its IUPAC name is (3R)-1-[(3,4-difluorophenyl)methyl]-3-hydroxy-3-[(2-methylsulfonylethylamino)methyl]piperidin-2-one.
| Compound Name | (3R)-1-[(3,4-difluorophenyl)methyl]-3-hydroxy-3-[(2-methylsulfonylethylamino)methyl]piperidin-2-one |
|---|---|
| PubChem CID | 95216266 |
| Molecular Formula | C16H22F2N2O4S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | (3R)-1-[(3,4-difluorophenyl)methyl]-3-hydroxy-3-[(2-methylsulfonylethylamino)methyl]piperidin-2-one |
| SMILES | CS(=O)(=O)CCNC[C@]1(O)CCCN(Cc2ccc(F)c(F)c2)C1=O |
| InChI | InChI=1S/C16H22F2N2O4S/c1-25(23,24)8-6-19-11-16(22)5-2-7-20(15(16)21)10-12-3-4-13(17)14(18)9-12/h3-4,9,19,22H,2,5-8,10-11H2,1H3/t16-/m1/s1 |
| InChIKey | HWNNGTGBPFRLBV-MRXNPFEDSA-N |
| XLogP | 0.45 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|