C17H27N3O4S — CID 56746440
2-[[3-hydroxy-1-[(3-methylphenyl)methyl]-2-oxopiperidin-3-yl]methylamino]-N-methylethanesulfonamide (PubChem CID 56746440) has the molecular formula C17H27N3O4S and a molecular weight of 369.49 g/mol. Its IUPAC name is 2-[[3-hydroxy-1-[(3-methylphenyl)methyl]-2-oxopiperidin-3-yl]methylamino]-N-methylethanesulfonamide.
| Compound Name | 2-[[3-hydroxy-1-[(3-methylphenyl)methyl]-2-oxopiperidin-3-yl]methylamino]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 56746440 |
| Molecular Formula | C17H27N3O4S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-[[3-hydroxy-1-[(3-methylphenyl)methyl]-2-oxopiperidin-3-yl]methylamino]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNCC1(O)CCCN(Cc2cccc(C)c2)C1=O |
| InChI | InChI=1S/C17H27N3O4S/c1-14-5-3-6-15(11-14)12-20-9-4-7-17(22,16(20)21)13-19-8-10-25(23,24)18-2/h3,5-6,11,18-19,22H,4,7-10,12-13H2,1-2H3 |
| InChIKey | JYZNAYNYAORIJP-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|