C19H25N3O2S — CID 95202805
(3R)-3-hydroxy-1-[(3-methylphenyl)methyl]-3-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]piperidin-2-one (PubChem CID 95202805) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is (3R)-3-hydroxy-1-[(3-methylphenyl)methyl]-3-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]piperidin-2-one.
| Compound Name | (3R)-3-hydroxy-1-[(3-methylphenyl)methyl]-3-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]piperidin-2-one |
|---|---|
| PubChem CID | 95202805 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (3R)-3-hydroxy-1-[(3-methylphenyl)methyl]-3-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]piperidin-2-one |
| SMILES | Cc1cccc(CN2CCC[C@@](O)(CNCCc3cscn3)C2=O)c1 |
| InChI | InChI=1S/C19H25N3O2S/c1-15-4-2-5-16(10-15)11-22-9-3-7-19(24,18(22)23)13-20-8-6-17-12-25-14-21-17/h2,4-5,10,12,14,20,24H,3,6-9,11,13H2,1H3/t19-/m1/s1 |
| InChIKey | FKVGLYUFZMZIIT-LJQANCHMSA-N |
| XLogP | 2.14 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|