C20H24N2 — CID 26397977
(3R)-1-(2,3-dihydro-1H-inden-2-yl)-N-phenylpiperidin-3-amine (PubChem CID 26397977) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is (3R)-1-(2,3-dihydro-1H-inden-2-yl)-N-phenylpiperidin-3-amine.
| Compound Name | (3R)-1-(2,3-dihydro-1H-inden-2-yl)-N-phenylpiperidin-3-amine |
|---|---|
| PubChem CID | 26397977 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (3R)-1-(2,3-dihydro-1H-inden-2-yl)-N-phenylpiperidin-3-amine |
| SMILES | c1ccc(N[C@@H]2CCCN(C3Cc4ccccc4C3)C2)cc1 |
| InChI | InChI=1S/C20H24N2/c1-2-9-18(10-3-1)21-19-11-6-12-22(15-19)20-13-16-7-4-5-8-17(16)14-20/h1-5,7-10,19-21H,6,11-15H2/t19-/m1/s1 |
| InChIKey | PHFZNAOSNHRWOD-LJQANCHMSA-N |
| XLogP | 3.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |