C18H34N6O — CID 26398153
N-[2-(dimethylamino)ethyl]-1-[1-(2-ethylbutyl)piperidin-4-yl]triazole-4-carboxamide (PubChem CID 26398153) has the molecular formula C18H34N6O and a molecular weight of 350.51 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-1-[1-(2-ethylbutyl)piperidin-4-yl]triazole-4-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-1-[1-(2-ethylbutyl)piperidin-4-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 26398153 |
| Molecular Formula | C18H34N6O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-1-[1-(2-ethylbutyl)piperidin-4-yl]triazole-4-carboxamide |
| SMILES | CCC(CC)CN1CCC(n2cc(C(=O)NCCN(C)C)nn2)CC1 |
| InChI | InChI=1S/C18H34N6O/c1-5-15(6-2)13-23-10-7-16(8-11-23)24-14-17(20-21-24)18(25)19-9-12-22(3)4/h14-16H,5-13H2,1-4H3,(H,19,25) |
| InChIKey | XDENHZAIZIHPED-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |