C13H24N6O3S — CID 70706077
1-(4-aminocyclohexyl)-N-[2-[methyl(methylsulfonyl)amino]ethyl]triazole-4-carboxamide (PubChem CID 70706077) has the molecular formula C13H24N6O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is 1-(4-aminocyclohexyl)-N-[2-[methyl(methylsulfonyl)amino]ethyl]triazole-4-carboxamide.
| Compound Name | 1-(4-aminocyclohexyl)-N-[2-[methyl(methylsulfonyl)amino]ethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 70706077 |
| Molecular Formula | C13H24N6O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 1-(4-aminocyclohexyl)-N-[2-[methyl(methylsulfonyl)amino]ethyl]triazole-4-carboxamide |
| SMILES | CN(CCNC(=O)c1cn(C2CCC(N)CC2)nn1)S(C)(=O)=O |
| InChI | InChI=1S/C13H24N6O3S/c1-18(23(2,21)22)8-7-15-13(20)12-9-19(17-16-12)11-5-3-10(14)4-6-11/h9-11H,3-8,14H2,1-2H3,(H,15,20) |
| InChIKey | UIIGAZCSQSLUMB-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |