C31H36N4O2 — CID 26399369
2,3-dimethyl-N-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]-N-(pyridin-2-ylmethyl)-1H-indole-7-carboxamide (PubChem CID 26399369) has the molecular formula C31H36N4O2 and a molecular weight of 496.66 g/mol. Its IUPAC name is 2,3-dimethyl-N-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]-N-(pyridin-2-ylmethyl)-1H-indole-7-carboxamide.
| Compound Name | 2,3-dimethyl-N-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]-N-(pyridin-2-ylmethyl)-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 26399369 |
| Molecular Formula | C31H36N4O2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | 2,3-dimethyl-N-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]-N-(pyridin-2-ylmethyl)-1H-indole-7-carboxamide |
| SMILES | Cc1[nH]c2c(C(=O)N(Cc3ccc(OCCN4CCCCC4)cc3)Cc3ccccn3)cccc2c1C |
| InChI | InChI=1S/C31H36N4O2/c1-23-24(2)33-30-28(23)10-8-11-29(30)31(36)35(22-26-9-4-5-16-32-26)21-25-12-14-27(15-13-25)37-20-19-34-17-6-3-7-18-34/h4-5,8-16,33H,3,6-7,17-22H2,1-2H3 |
| InChIKey | BNUSTSSLZFFNIS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|