C21H26N4O3 — CID 26403384
(2R)-1-N-butyl-2-N-(2-pyridin-3-yloxyphenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 26403384) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is (2R)-1-N-butyl-2-N-(2-pyridin-3-yloxyphenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R)-1-N-butyl-2-N-(2-pyridin-3-yloxyphenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 26403384 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (2R)-1-N-butyl-2-N-(2-pyridin-3-yloxyphenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | CCCCNC(=O)N1CCC[C@@H]1C(=O)Nc1ccccc1Oc1cccnc1 |
| InChI | InChI=1S/C21H26N4O3/c1-2-3-13-23-21(27)25-14-7-10-18(25)20(26)24-17-9-4-5-11-19(17)28-16-8-6-12-22-15-16/h4-6,8-9,11-12,15,18H,2-3,7,10,13-14H2,1H3,(H,23,27)(H,24,26)/t18-/m1/s1 |
| InChIKey | FCKYLLDXLZBCPG-GOSISDBHSA-N |
| XLogP | 3.79 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|