C25H27N3O2 — CID 42199128
(3R)-1-(2-phenylethyl)-N-(2-pyridin-3-yloxyphenyl)piperidine-3-carboxamide (PubChem CID 42199128) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is (3R)-1-(2-phenylethyl)-N-(2-pyridin-3-yloxyphenyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(2-phenylethyl)-N-(2-pyridin-3-yloxyphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42199128 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | (3R)-1-(2-phenylethyl)-N-(2-pyridin-3-yloxyphenyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1Oc1cccnc1)[C@@H]1CCCN(CCc2ccccc2)C1 |
| InChI | InChI=1S/C25H27N3O2/c29-25(21-10-7-16-28(19-21)17-14-20-8-2-1-3-9-20)27-23-12-4-5-13-24(23)30-22-11-6-15-26-18-22/h1-6,8-9,11-13,15,18,21H,7,10,14,16-17,19H2,(H,27,29)/t21-/m1/s1 |
| InChIKey | UMDWUBFPGJPKCT-OAQYLSRUSA-N |
| XLogP | 4.77 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |