C22H23N5O2 — CID 97273822
(3S)-1-(6-methylpyrimidin-4-yl)-N-(2-pyridin-3-yloxyphenyl)piperidine-3-carboxamide (PubChem CID 97273822) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is (3S)-1-(6-methylpyrimidin-4-yl)-N-(2-pyridin-3-yloxyphenyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-(6-methylpyrimidin-4-yl)-N-(2-pyridin-3-yloxyphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 97273822 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | (3S)-1-(6-methylpyrimidin-4-yl)-N-(2-pyridin-3-yloxyphenyl)piperidine-3-carboxamide |
| SMILES | Cc1cc(N2CCC[C@H](C(=O)Nc3ccccc3Oc3cccnc3)C2)ncn1 |
| InChI | InChI=1S/C22H23N5O2/c1-16-12-21(25-15-24-16)27-11-5-6-17(14-27)22(28)26-19-8-2-3-9-20(19)29-18-7-4-10-23-13-18/h2-4,7-10,12-13,15,17H,5-6,11,14H2,1H3,(H,26,28)/t17-/m0/s1 |
| InChIKey | LXYKYINBHNKDSP-KRWDZBQOSA-N |
| XLogP | 3.83 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |