C19H26N2O5 — CID 26406507
methyl 4-[[(3R)-1-[(2-methoxyphenyl)methyl]-6-oxopiperidine-3-carbonyl]amino]butanoate (PubChem CID 26406507) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is methyl 4-[[(3R)-1-[(2-methoxyphenyl)methyl]-6-oxopiperidine-3-carbonyl]amino]butanoate.
| Compound Name | methyl 4-[[(3R)-1-[(2-methoxyphenyl)methyl]-6-oxopiperidine-3-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 26406507 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | methyl 4-[[(3R)-1-[(2-methoxyphenyl)methyl]-6-oxopiperidine-3-carbonyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)[C@@H]1CCC(=O)N(Cc2ccccc2OC)C1 |
| InChI | InChI=1S/C19H26N2O5/c1-25-16-7-4-3-6-14(16)12-21-13-15(9-10-17(21)22)19(24)20-11-5-8-18(23)26-2/h3-4,6-7,15H,5,8-13H2,1-2H3,(H,20,24)/t15-/m1/s1 |
| InChIKey | OPKFRGYCPSJVGB-OAHLLOKOSA-N |
| XLogP | 1.50 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|