C21H30FN3O2 — CID 72852888
1-[(2-fluorophenyl)methyl]-6-oxo-N-(4-pyrrolidin-1-ylbutyl)piperidine-3-carboxamide (PubChem CID 72852888) has the molecular formula C21H30FN3O2 and a molecular weight of 375.49 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-6-oxo-N-(4-pyrrolidin-1-ylbutyl)piperidine-3-carboxamide.
| Compound Name | 1-[(2-fluorophenyl)methyl]-6-oxo-N-(4-pyrrolidin-1-ylbutyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 72852888 |
| Molecular Formula | C21H30FN3O2 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-6-oxo-N-(4-pyrrolidin-1-ylbutyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCCCN1CCCC1)C1CCC(=O)N(Cc2ccccc2F)C1 |
| InChI | InChI=1S/C21H30FN3O2/c22-19-8-2-1-7-17(19)15-25-16-18(9-10-20(25)26)21(27)23-11-3-4-12-24-13-5-6-14-24/h1-2,7-8,18H,3-6,9-16H2,(H,23,27) |
| InChIKey | FAHPWUGGMNZGQG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|