C21H27FN2O3 — CID 25366722
(3S)-1-[(2-fluorophenyl)methyl]-N-(2-hydroxy-2-prop-2-enylpent-4-enyl)-6-oxopiperidine-3-carboxamide (PubChem CID 25366722) has the molecular formula C21H27FN2O3 and a molecular weight of 374.46 g/mol. Its IUPAC name is (3S)-1-[(2-fluorophenyl)methyl]-N-(2-hydroxy-2-prop-2-enylpent-4-enyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | (3S)-1-[(2-fluorophenyl)methyl]-N-(2-hydroxy-2-prop-2-enylpent-4-enyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 25366722 |
| Molecular Formula | C21H27FN2O3 |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | (3S)-1-[(2-fluorophenyl)methyl]-N-(2-hydroxy-2-prop-2-enylpent-4-enyl)-6-oxopiperidine-3-carboxamide |
| SMILES | C=CCC(O)(CC=C)CNC(=O)[C@H]1CCC(=O)N(Cc2ccccc2F)C1 |
| InChI | InChI=1S/C21H27FN2O3/c1-3-11-21(27,12-4-2)15-23-20(26)17-9-10-19(25)24(14-17)13-16-7-5-6-8-18(16)22/h3-8,17,27H,1-2,9-15H2,(H,23,26)/t17-/m0/s1 |
| InChIKey | IXBKYWPAWFGILD-KRWDZBQOSA-N |
| XLogP | 2.56 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|