C22H32FN3O2 — CID 25281331
(3R)-N-[3-[cyclopentyl(methyl)amino]propyl]-1-[(2-fluorophenyl)methyl]-6-oxopiperidine-3-carboxamide (PubChem CID 25281331) has the molecular formula C22H32FN3O2 and a molecular weight of 389.52 g/mol. Its IUPAC name is (3R)-N-[3-[cyclopentyl(methyl)amino]propyl]-1-[(2-fluorophenyl)methyl]-6-oxopiperidine-3-carboxamide.
| Compound Name | (3R)-N-[3-[cyclopentyl(methyl)amino]propyl]-1-[(2-fluorophenyl)methyl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 25281331 |
| Molecular Formula | C22H32FN3O2 |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | (3R)-N-[3-[cyclopentyl(methyl)amino]propyl]-1-[(2-fluorophenyl)methyl]-6-oxopiperidine-3-carboxamide |
| SMILES | CN(CCCNC(=O)[C@@H]1CCC(=O)N(Cc2ccccc2F)C1)C1CCCC1 |
| InChI | InChI=1S/C22H32FN3O2/c1-25(19-8-3-4-9-19)14-6-13-24-22(28)18-11-12-21(27)26(16-18)15-17-7-2-5-10-20(17)23/h2,5,7,10,18-19H,3-4,6,8-9,11-16H2,1H3,(H,24,28)/t18-/m1/s1 |
| InChIKey | CKXLTLMUQGTBLA-GOSISDBHSA-N |
| XLogP | 2.94 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|