C21H25FN4O2 — CID 97114771
(3S)-1-[(2-fluorophenyl)methyl]-N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]-6-oxopiperidine-3-carboxamide (PubChem CID 97114771) has the molecular formula C21H25FN4O2 and a molecular weight of 384.45 g/mol. Its IUPAC name is (3S)-1-[(2-fluorophenyl)methyl]-N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]-6-oxopiperidine-3-carboxamide.
| Compound Name | (3S)-1-[(2-fluorophenyl)methyl]-N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 97114771 |
| Molecular Formula | C21H25FN4O2 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (3S)-1-[(2-fluorophenyl)methyl]-N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]-6-oxopiperidine-3-carboxamide |
| SMILES | Cc1ccnc(NCCNC(=O)[C@H]2CCC(=O)N(Cc3ccccc3F)C2)c1 |
| InChI | InChI=1S/C21H25FN4O2/c1-15-8-9-23-19(12-15)24-10-11-25-21(28)17-6-7-20(27)26(14-17)13-16-4-2-3-5-18(16)22/h2-5,8-9,12,17H,6-7,10-11,13-14H2,1H3,(H,23,24)(H,25,28)/t17-/m0/s1 |
| InChIKey | FXMBRRBRQTXTDI-KRWDZBQOSA-N |
| XLogP | 2.50 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|