C21H35N3O4 — CID 29257686
(3S)-N-(2-hydroxy-2-prop-2-enylpent-4-enyl)-1-(3-morpholin-4-ylpropyl)-6-oxopiperidine-3-carboxamide (PubChem CID 29257686) has the molecular formula C21H35N3O4 and a molecular weight of 393.53 g/mol. Its IUPAC name is (3S)-N-(2-hydroxy-2-prop-2-enylpent-4-enyl)-1-(3-morpholin-4-ylpropyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | (3S)-N-(2-hydroxy-2-prop-2-enylpent-4-enyl)-1-(3-morpholin-4-ylpropyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 29257686 |
| Molecular Formula | C21H35N3O4 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | (3S)-N-(2-hydroxy-2-prop-2-enylpent-4-enyl)-1-(3-morpholin-4-ylpropyl)-6-oxopiperidine-3-carboxamide |
| SMILES | C=CCC(O)(CC=C)CNC(=O)[C@H]1CCC(=O)N(CCCN2CCOCC2)C1 |
| InChI | InChI=1S/C21H35N3O4/c1-3-8-21(27,9-4-2)17-22-20(26)18-6-7-19(25)24(16-18)11-5-10-23-12-14-28-15-13-23/h3-4,18,27H,1-2,5-17H2,(H,22,26)/t18-/m0/s1 |
| InChIKey | VUHBVOUXUFRVCP-SFHVURJKSA-N |
| XLogP | 0.95 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|