C18H29N5O3 — CID 97146221
(3S)-N-(2-imidazol-1-ylethyl)-1-(3-morpholin-4-ylpropyl)-6-oxopiperidine-3-carboxamide (PubChem CID 97146221) has the molecular formula C18H29N5O3 and a molecular weight of 363.46 g/mol. Its IUPAC name is (3S)-N-(2-imidazol-1-ylethyl)-1-(3-morpholin-4-ylpropyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | (3S)-N-(2-imidazol-1-ylethyl)-1-(3-morpholin-4-ylpropyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 97146221 |
| Molecular Formula | C18H29N5O3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | (3S)-N-(2-imidazol-1-ylethyl)-1-(3-morpholin-4-ylpropyl)-6-oxopiperidine-3-carboxamide |
| SMILES | O=C(NCCn1ccnc1)[C@H]1CCC(=O)N(CCCN2CCOCC2)C1 |
| InChI | InChI=1S/C18H29N5O3/c24-17-3-2-16(18(25)20-5-9-22-8-4-19-15-22)14-23(17)7-1-6-21-10-12-26-13-11-21/h4,8,15-16H,1-3,5-7,9-14H2,(H,20,25)/t16-/m0/s1 |
| InChIKey | WESIZMSUEQYOIA-INIZCTEOSA-N |
| XLogP | -0.04 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |