C17H31N3O3S — CID 28768875
(3R)-N-(3-methylsulfanylpropyl)-1-(3-morpholin-4-ylpropyl)-6-oxopiperidine-3-carboxamide (PubChem CID 28768875) has the molecular formula C17H31N3O3S and a molecular weight of 357.52 g/mol. Its IUPAC name is (3R)-N-(3-methylsulfanylpropyl)-1-(3-morpholin-4-ylpropyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | (3R)-N-(3-methylsulfanylpropyl)-1-(3-morpholin-4-ylpropyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 28768875 |
| Molecular Formula | C17H31N3O3S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (3R)-N-(3-methylsulfanylpropyl)-1-(3-morpholin-4-ylpropyl)-6-oxopiperidine-3-carboxamide |
| SMILES | CSCCCNC(=O)[C@@H]1CCC(=O)N(CCCN2CCOCC2)C1 |
| InChI | InChI=1S/C17H31N3O3S/c1-24-13-2-6-18-17(22)15-4-5-16(21)20(14-15)8-3-7-19-9-11-23-12-10-19/h15H,2-14H2,1H3,(H,18,22)/t15-/m1/s1 |
| InChIKey | MHOLFLGKKKDAAF-OAHLLOKOSA-N |
| XLogP | 0.82 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|