C15H27N3O3S — CID 30853089
(3R)-N-(2-methylsulfanylethyl)-1-(2-morpholin-4-ylethyl)-6-oxopiperidine-3-carboxamide (PubChem CID 30853089) has the molecular formula C15H27N3O3S and a molecular weight of 329.47 g/mol. Its IUPAC name is (3R)-N-(2-methylsulfanylethyl)-1-(2-morpholin-4-ylethyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | (3R)-N-(2-methylsulfanylethyl)-1-(2-morpholin-4-ylethyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 30853089 |
| Molecular Formula | C15H27N3O3S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | (3R)-N-(2-methylsulfanylethyl)-1-(2-morpholin-4-ylethyl)-6-oxopiperidine-3-carboxamide |
| SMILES | CSCCNC(=O)[C@@H]1CCC(=O)N(CCN2CCOCC2)C1 |
| InChI | InChI=1S/C15H27N3O3S/c1-22-11-4-16-15(20)13-2-3-14(19)18(12-13)6-5-17-7-9-21-10-8-17/h13H,2-12H2,1H3,(H,16,20)/t13-/m1/s1 |
| InChIKey | XHZWUNMIOQXVOI-CYBMUJFWSA-N |
| XLogP | 0.04 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|