C27H28N2O2S — CID 26409080
(3S)-1-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-N-[3-(3-methylphenyl)phenyl]piperidine-3-carboxamide (PubChem CID 26409080) has the molecular formula C27H28N2O2S and a molecular weight of 444.60 g/mol. Its IUPAC name is (3S)-1-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-N-[3-(3-methylphenyl)phenyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-N-[3-(3-methylphenyl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 26409080 |
| Molecular Formula | C27H28N2O2S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | (3S)-1-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-N-[3-(3-methylphenyl)phenyl]piperidine-3-carboxamide |
| SMILES | Cc1cccc(-c2cccc(NC(=O)[C@H]3CCCN(Cc4ccc(C#CCO)s4)C3)c2)c1 |
| InChI | InChI=1S/C27H28N2O2S/c1-20-6-2-7-21(16-20)22-8-3-10-24(17-22)28-27(31)23-9-4-14-29(18-23)19-26-13-12-25(32-26)11-5-15-30/h2-3,6-8,10,12-13,16-17,23,30H,4,9,14-15,18-19H2,1H3,(H,28,31)/t23-/m0/s1 |
| InChIKey | UAUKZZTZNZNNSW-QHCPKHFHSA-N |
| XLogP | 4.92 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|