C17H21NO3S2 — CID 26410413
(2S)-2-(3-phenylpropyl)-4-thiophen-3-ylsulfonylmorpholine (PubChem CID 26410413) has the molecular formula C17H21NO3S2 and a molecular weight of 351.49 g/mol. Its IUPAC name is (2S)-2-(3-phenylpropyl)-4-thiophen-3-ylsulfonylmorpholine.
| Compound Name | (2S)-2-(3-phenylpropyl)-4-thiophen-3-ylsulfonylmorpholine |
|---|---|
| PubChem CID | 26410413 |
| Molecular Formula | C17H21NO3S2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | (2S)-2-(3-phenylpropyl)-4-thiophen-3-ylsulfonylmorpholine |
| SMILES | O=S(=O)(c1ccsc1)N1CCO[C@@H](CCCc2ccccc2)C1 |
| InChI | InChI=1S/C17H21NO3S2/c19-23(20,17-9-12-22-14-17)18-10-11-21-16(13-18)8-4-7-15-5-2-1-3-6-15/h1-3,5-6,9,12,14,16H,4,7-8,10-11,13H2/t16-/m0/s1 |
| InChIKey | YSZPQWPODXGYNT-INIZCTEOSA-N |
| XLogP | 3.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |