C16H13FN2O2S — CID 2641094
N-(6-fluoro-1,3-benzothiazol-2-yl)-2-(2-methoxyphenyl)acetamide (PubChem CID 2641094) has the molecular formula C16H13FN2O2S and a molecular weight of 316.36 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-2-(2-methoxyphenyl)acetamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-2-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2641094 |
| Molecular Formula | C16H13FN2O2S |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-2-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1CC(=O)Nc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C16H13FN2O2S/c1-21-13-5-3-2-4-10(13)8-15(20)19-16-18-12-7-6-11(17)9-14(12)22-16/h2-7,9H,8H2,1H3,(H,18,19,20) |
| InChIKey | VYWBPDVFCVAPFK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |