C14H15NO6 — CID 26412216
(1R,2S,4R)-4-(4-nitrophenyl)cyclohexane-1,2-dicarboxylic acid (PubChem CID 26412216) has the molecular formula C14H15NO6 and a molecular weight of 293.27 g/mol. Its IUPAC name is (1R,2S,4R)-4-(4-nitrophenyl)cyclohexane-1,2-dicarboxylic acid.
| Compound Name | (1R,2S,4R)-4-(4-nitrophenyl)cyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 26412216 |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | (1R,2S,4R)-4-(4-nitrophenyl)cyclohexane-1,2-dicarboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@H](c2ccc([N+](=O)[O-])cc2)CC[C@H]1C(=O)O |
| InChI | InChI=1S/C14H15NO6/c16-13(17)11-6-3-9(7-12(11)14(18)19)8-1-4-10(5-2-8)15(20)21/h1-2,4-5,9,11-12H,3,6-7H2,(H,16,17)(H,18,19)/t9-,11-,12+/m1/s1 |
| InChIKey | DSFVKIUHMVTNOT-JLLWLGSASA-N |
| XLogP | 2.26 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|