C10H15N5O3S — CID 26434472
N-(2-methoxyethyl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide (PubChem CID 26434472) has the molecular formula C10H15N5O3S and a molecular weight of 285.33 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide.
| Compound Name | N-(2-methoxyethyl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide |
|---|---|
| PubChem CID | 26434472 |
| Molecular Formula | C10H15N5O3S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-(2-methoxyethyl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide |
| SMILES | COCCNS(=O)(=O)c1nc2nc(C)cc(C)n2n1 |
| InChI | InChI=1S/C10H15N5O3S/c1-7-6-8(2)15-9(12-7)13-10(14-15)19(16,17)11-4-5-18-3/h6,11H,4-5H2,1-3H3 |
| InChIKey | SLQLJRBYLCSVDD-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|