C24H28FN5O4 — CID 26439800
N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-(4-fluoro-2-methylanilino)-N-(3-methoxypropyl)acetamide (PubChem CID 26439800) has the molecular formula C24H28FN5O4 and a molecular weight of 469.52 g/mol. Its IUPAC name is N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-(4-fluoro-2-methylanilino)-N-(3-methoxypropyl)acetamide.
| Compound Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-(4-fluoro-2-methylanilino)-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 26439800 |
| Molecular Formula | C24H28FN5O4 |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-(4-fluoro-2-methylanilino)-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCN(C(=O)CNc1ccc(F)cc1C)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H28FN5O4/c1-16-13-18(25)9-10-19(16)27-14-20(31)29(11-6-12-34-2)21-22(26)30(24(33)28-23(21)32)15-17-7-4-3-5-8-17/h3-5,7-10,13,27H,6,11-12,14-15,26H2,1-2H3,(H,28,32,33) |
| InChIKey | XLIFLIAZAXGRQI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|