C25H24N4OS — CID 26448373
piperidin-1-yl-[4-[[(2-thiophen-2-ylquinazolin-4-yl)amino]methyl]phenyl]methanone (PubChem CID 26448373) has the molecular formula C25H24N4OS and a molecular weight of 428.56 g/mol. Its IUPAC name is piperidin-1-yl-[4-[[(2-thiophen-2-ylquinazolin-4-yl)amino]methyl]phenyl]methanone.
| Compound Name | piperidin-1-yl-[4-[[(2-thiophen-2-ylquinazolin-4-yl)amino]methyl]phenyl]methanone |
|---|---|
| PubChem CID | 26448373 |
| Molecular Formula | C25H24N4OS |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | piperidin-1-yl-[4-[[(2-thiophen-2-ylquinazolin-4-yl)amino]methyl]phenyl]methanone |
| SMILES | O=C(c1ccc(CNc2nc(-c3cccs3)nc3ccccc23)cc1)N1CCCCC1 |
| InChI | InChI=1S/C25H24N4OS/c30-25(29-14-4-1-5-15-29)19-12-10-18(11-13-19)17-26-23-20-7-2-3-8-21(20)27-24(28-23)22-9-6-16-31-22/h2-3,6-13,16H,1,4-5,14-15,17H2,(H,26,27,28) |
| InChIKey | HDFIRTZJBMLFOR-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |