C17H15N5O6S — CID 26453982
2-[4-(2,4-dinitrophenyl)piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 26453982) has the molecular formula C17H15N5O6S and a molecular weight of 417.40 g/mol. Its IUPAC name is 2-[4-(2,4-dinitrophenyl)piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-[4-(2,4-dinitrophenyl)piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 26453982 |
| Molecular Formula | C17H15N5O6S |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 2-[4-(2,4-dinitrophenyl)piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | N#Cc1ccccc1S(=O)(=O)N1CCN(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H15N5O6S/c18-12-13-3-1-2-4-17(13)29(27,28)20-9-7-19(8-10-20)15-6-5-14(21(23)24)11-16(15)22(25)26/h1-6,11H,7-10H2 |
| InChIKey | ZBZSTWGXXALYET-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 150.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|