C17H14Cl2N4O4S — CID 29107230
4-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-3-nitrobenzonitrile (PubChem CID 29107230) has the molecular formula C17H14Cl2N4O4S and a molecular weight of 441.30 g/mol. Its IUPAC name is 4-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-3-nitrobenzonitrile.
| Compound Name | 4-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 29107230 |
| Molecular Formula | C17H14Cl2N4O4S |
| Molecular Weight | 441.30 g/mol |
| Exact Mass | 440.01 |
| IUPAC Name | 4-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-3-nitrobenzonitrile |
| SMILES | N#Cc1ccc(N2CCN(S(=O)(=O)c3c(Cl)cccc3Cl)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H14Cl2N4O4S/c18-13-2-1-3-14(19)17(13)28(26,27)22-8-6-21(7-9-22)15-5-4-12(11-20)10-16(15)23(24)25/h1-5,10H,6-9H2 |
| InChIKey | PFFBBAVJZHYDIZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 107.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|