C21H28N4O3S2 — CID 26460072
1-[[4-[ethyl(phenyl)sulfamoyl]benzoyl]amino]-1-methyl-3-(2-methylpropyl)thiourea (PubChem CID 26460072) has the molecular formula C21H28N4O3S2 and a molecular weight of 448.61 g/mol. Its IUPAC name is 1-[[4-[ethyl(phenyl)sulfamoyl]benzoyl]amino]-1-methyl-3-(2-methylpropyl)thiourea.
| Compound Name | 1-[[4-[ethyl(phenyl)sulfamoyl]benzoyl]amino]-1-methyl-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 26460072 |
| Molecular Formula | C21H28N4O3S2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 1-[[4-[ethyl(phenyl)sulfamoyl]benzoyl]amino]-1-methyl-3-(2-methylpropyl)thiourea |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)NN(C)C(=S)NCC(C)C)cc1 |
| InChI | InChI=1S/C21H28N4O3S2/c1-5-25(18-9-7-6-8-10-18)30(27,28)19-13-11-17(12-14-19)20(26)23-24(4)21(29)22-15-16(2)3/h6-14,16H,5,15H2,1-4H3,(H,22,29)(H,23,26) |
| InChIKey | MTWGESDBICFCJX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|