C20H18F3N3O5S — CID 26466112
3-(2-oxo-6-pyrrolidin-1-ylsulfonyl-1,3-benzoxazol-3-yl)-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 26466112) has the molecular formula C20H18F3N3O5S and a molecular weight of 469.44 g/mol. Its IUPAC name is 3-(2-oxo-6-pyrrolidin-1-ylsulfonyl-1,3-benzoxazol-3-yl)-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | 3-(2-oxo-6-pyrrolidin-1-ylsulfonyl-1,3-benzoxazol-3-yl)-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 26466112 |
| Molecular Formula | C20H18F3N3O5S |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 3-(2-oxo-6-pyrrolidin-1-ylsulfonyl-1,3-benzoxazol-3-yl)-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | O=C(CCn1c(=O)oc2cc(S(=O)(=O)N3CCCC3)ccc21)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H18F3N3O5S/c21-13-4-5-14(19(23)18(13)22)24-17(27)7-10-26-15-6-3-12(11-16(15)31-20(26)28)32(29,30)25-8-1-2-9-25/h3-6,11H,1-2,7-10H2,(H,24,27) |
| InChIKey | CVEDXTZITXOSPU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|