C14H16FNO6 — CID 26470888
(2S,3R,4R,5R,6S)-2-[(6-fluoro-1H-indol-3-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 26470888) has the molecular formula C14H16FNO6 and a molecular weight of 313.28 g/mol. Its IUPAC name is (2S,3R,4R,5R,6S)-2-[(6-fluoro-1H-indol-3-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5R,6S)-2-[(6-fluoro-1H-indol-3-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 26470888 |
| Molecular Formula | C14H16FNO6 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (2S,3R,4R,5R,6S)-2-[(6-fluoro-1H-indol-3-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@@H]1O[C@@H](Oc2c[nH]c3cc(F)ccc23)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H16FNO6/c15-6-1-2-7-8(3-6)16-4-9(7)21-14-13(20)12(19)11(18)10(5-17)22-14/h1-4,10-14,16-20H,5H2/t10-,11-,12+,13+,14+/m0/s1 |
| InChIKey | RXOOACBEXDNIAY-ODXJTPSBSA-N |
| XLogP | -0.51 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |