C16H17Cl2NO4S — CID 2647431
[2-(butylamino)-2-oxoethyl] 3,7-dichloro-6-methoxy-1-benzothiophene-2-carboxylate (PubChem CID 2647431) has the molecular formula C16H17Cl2NO4S and a molecular weight of 390.29 g/mol. Its IUPAC name is [2-(butylamino)-2-oxoethyl] 3,7-dichloro-6-methoxy-1-benzothiophene-2-carboxylate.
| Compound Name | [2-(butylamino)-2-oxoethyl] 3,7-dichloro-6-methoxy-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 2647431 |
| Molecular Formula | C16H17Cl2NO4S |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | [2-(butylamino)-2-oxoethyl] 3,7-dichloro-6-methoxy-1-benzothiophene-2-carboxylate |
| SMILES | CCCCNC(=O)COC(=O)c1sc2c(Cl)c(OC)ccc2c1Cl |
| InChI | InChI=1S/C16H17Cl2NO4S/c1-3-4-7-19-11(20)8-23-16(21)15-12(17)9-5-6-10(22-2)13(18)14(9)24-15/h5-6H,3-4,7-8H2,1-2H3,(H,19,20) |
| InChIKey | BEKVDAMNJUVCPP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|