C20H29NOS — CID 26477918
(2R)-8-tert-butyl-2-methyl-4-(4-methylphenyl)-1-thia-4-azaspiro[4.5]decan-3-one (PubChem CID 26477918) has the molecular formula C20H29NOS and a molecular weight of 331.53 g/mol. Its IUPAC name is (2R)-8-tert-butyl-2-methyl-4-(4-methylphenyl)-1-thia-4-azaspiro[4.5]decan-3-one.
| Compound Name | (2R)-8-tert-butyl-2-methyl-4-(4-methylphenyl)-1-thia-4-azaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 26477918 |
| Molecular Formula | C20H29NOS |
| Molecular Weight | 331.53 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | (2R)-8-tert-butyl-2-methyl-4-(4-methylphenyl)-1-thia-4-azaspiro[4.5]decan-3-one |
| SMILES | Cc1ccc(N2C(=O)[C@@H](C)SC23CCC(C(C)(C)C)CC3)cc1 |
| InChI | InChI=1S/C20H29NOS/c1-14-6-8-17(9-7-14)21-18(22)15(2)23-20(21)12-10-16(11-13-20)19(3,4)5/h6-9,15-16H,10-13H2,1-5H3/t15-,16?,20?/m1/s1 |
| InChIKey | PJVWUULMSQJZFS-LSWWBPAMSA-N |
| XLogP | 5.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |