C26H29N3O2 — CID 134090546
4-tert-butyl-1-(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)cyclohexane-1-carbonitrile (PubChem CID 134090546) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 4-tert-butyl-1-(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)cyclohexane-1-carbonitrile.
| Compound Name | 4-tert-butyl-1-(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 134090546 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 4-tert-butyl-1-(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)cyclohexane-1-carbonitrile |
| SMILES | CC(C)(C)C1CCC(C#N)(C2C(=O)N(c3ccccc3)N(c3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C26H29N3O2/c1-25(2,3)19-14-16-26(18-27,17-15-19)22-23(30)28(20-10-6-4-7-11-20)29(24(22)31)21-12-8-5-9-13-21/h4-13,19,22H,14-17H2,1-3H3 |
| InChIKey | QMTMZHAIADSPGD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|