C28H20Cl2N2O — CID 26517398
(8R,11R)-8-(2,3-dichlorophenyl)-11-phenyl-8,10,11,12-tetrahydro-7H-benzo[a][4,7]phenanthrolin-9-one (PubChem CID 26517398) has the molecular formula C28H20Cl2N2O and a molecular weight of 471.39 g/mol. Its IUPAC name is (8R,11R)-8-(2,3-dichlorophenyl)-11-phenyl-8,10,11,12-tetrahydro-7H-benzo[a][4,7]phenanthrolin-9-one.
| Compound Name | (8R,11R)-8-(2,3-dichlorophenyl)-11-phenyl-8,10,11,12-tetrahydro-7H-benzo[a][4,7]phenanthrolin-9-one |
|---|---|
| PubChem CID | 26517398 |
| Molecular Formula | C28H20Cl2N2O |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | (8R,11R)-8-(2,3-dichlorophenyl)-11-phenyl-8,10,11,12-tetrahydro-7H-benzo[a][4,7]phenanthrolin-9-one |
| SMILES | O=C1C[C@H](c2ccccc2)CC2=C1[C@H](c1cccc(Cl)c1Cl)Nc1ccc3ncccc3c12 |
| InChI | InChI=1S/C28H20Cl2N2O/c29-21-10-4-8-19(27(21)30)28-26-20(14-17(15-24(26)33)16-6-2-1-3-7-16)25-18-9-5-13-31-22(18)11-12-23(25)32-28/h1-13,17,28,32H,14-15H2/t17-,28+/m1/s1 |
| InChIKey | PHSZLRAMRLIBSO-UULLZXFKSA-N |
| XLogP | 7.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |