C14H26N2OS — CID 26536311
(2S,6R)-2,6-dimethyl-N-[(1R,2S)-2-methylcyclohexyl]morpholine-4-carbothioamide (PubChem CID 26536311) has the molecular formula C14H26N2OS and a molecular weight of 270.44 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-N-[(1R,2S)-2-methylcyclohexyl]morpholine-4-carbothioamide.
| Compound Name | (2S,6R)-2,6-dimethyl-N-[(1R,2S)-2-methylcyclohexyl]morpholine-4-carbothioamide |
|---|---|
| PubChem CID | 26536311 |
| Molecular Formula | C14H26N2OS |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-N-[(1R,2S)-2-methylcyclohexyl]morpholine-4-carbothioamide |
| SMILES | C[C@@H]1CN(C(=S)N[C@@H]2CCCC[C@@H]2C)C[C@H](C)O1 |
| InChI | InChI=1S/C14H26N2OS/c1-10-6-4-5-7-13(10)15-14(18)16-8-11(2)17-12(3)9-16/h10-13H,4-9H2,1-3H3,(H,15,18)/t10-,11-,12+,13+/m0/s1 |
| InChIKey | QUFVLFPSIYBMPO-WUHRBBMRSA-N |
| XLogP | 2.55 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|